C19H13F3N4 — CID 155551586
3-[3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-yl]aniline (PubChem CID 155551586) has the molecular formula C19H13F3N4 and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-[3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-yl]aniline.
| Compound Name | 3-[3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-yl]aniline |
|---|---|
| PubChem CID | 155551586 |
| Molecular Formula | C19H13F3N4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-[3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-yl]aniline |
| SMILES | Nc1cccc(-c2ccc3ncc(-c4cccc(C(F)(F)F)c4)n3n2)c1 |
| InChI | InChI=1S/C19H13F3N4/c20-19(21,22)14-5-1-4-13(9-14)17-11-24-18-8-7-16(25-26(17)18)12-3-2-6-15(23)10-12/h1-11H,23H2 |
| InChIKey | SLDONAKOQXVYCS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|