About 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine
6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine (PubChem CID 168873710) has the molecular formula C20H20F3N5
and a molecular weight of 387.41 g/mol. Its IUPAC name is 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine |
| PubChem CID | 168873710 |
| Molecular Formula | C20H20F3N5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine |
| SMILES | FC(F)(F)c1cccc(-c2cnc3ccc(N4CC5(CCNCC5)C4)nn23)c1 |
| InChI | InChI=1S/C20H20F3N5/c21-20(22,23)15-3-1-2-14(10-15)16-11-25-17-4-5-18(26-28(16)17)27-12-19(13-27)6-8-24-9-7-19/h1-5,10-11,24H,6-9,12-13H2 |
| InChIKey | YMHKXWMFWHITPH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine?
The IUPAC name of 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine (CID 168873710) is 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine?
The canonical SMILES for 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine is FC(F)(F)c1cccc(-c2cnc3ccc(N4CC5(CCNCC5)C4)nn23)c1.
What is the InChIKey of 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine?
The InChIKey is YMHKXWMFWHITPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N5/c21-20(22,23)15-3-1-2-14(10-15)16-11-25-17-4-5-18(26-28(16)17)27-12-19(13-27)6-8-24-9-7-19/h1-5,10-11,24H,6-9,12-13H2.
What are the key properties of 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine?
6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine has a molecular weight of 387.41 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine is sourced from PubChem (CID 168873710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).