C18H17F3N4O — CID 167228039
N-(oxan-3-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 167228039) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is N-(oxan-3-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-(oxan-3-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 167228039 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-(oxan-3-yl)-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | FC(F)(F)c1cccc(-c2cnc3ccc(NC4CCCOC4)nn23)c1 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)13-4-1-3-12(9-13)15-10-22-17-7-6-16(24-25(15)17)23-14-5-2-8-26-11-14/h1,3-4,6-7,9-10,14H,2,5,8,11H2,(H,23,24) |
| InChIKey | IMRZVLUDFQQOTC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |