C19H20N4O2 — CID 25102960
3-[6-(cyclohexylamino)imidazo[1,2-b]pyridazin-3-yl]benzoic acid (PubChem CID 25102960) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[6-(cyclohexylamino)imidazo[1,2-b]pyridazin-3-yl]benzoic acid.
| Compound Name | 3-[6-(cyclohexylamino)imidazo[1,2-b]pyridazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 25102960 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-[6-(cyclohexylamino)imidazo[1,2-b]pyridazin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cnc3ccc(NC4CCCCC4)nn23)c1 |
| InChI | InChI=1S/C19H20N4O2/c24-19(25)14-6-4-5-13(11-14)16-12-20-18-10-9-17(22-23(16)18)21-15-7-2-1-3-8-15/h4-6,9-12,15H,1-3,7-8H2,(H,21,22)(H,24,25) |
| InChIKey | CWPJMRQVTMMOPY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |