C13H8F4N4 — CID 134360127
N-fluoro-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 134360127) has the molecular formula C13H8F4N4 and a molecular weight of 296.23 g/mol. Its IUPAC name is N-fluoro-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-fluoro-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 134360127 |
| Molecular Formula | C13H8F4N4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-fluoro-3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | FNc1ccc2ncc(-c3cccc(C(F)(F)F)c3)n2n1 |
| InChI | InChI=1S/C13H8F4N4/c14-13(15,16)9-3-1-2-8(6-9)10-7-18-12-5-4-11(19-17)20-21(10)12/h1-7H,(H,19,20) |
| InChIKey | JWNNZXZMDYYVNG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|