C13H8F3N3 — CID 140652262
3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine (PubChem CID 140652262) has the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 140652262 |
| Molecular Formula | C13H8F3N3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]imidazo[1,2-b]pyridazine |
| SMILES | FC(F)(F)c1cccc(-c2cnc3cccnn23)c1 |
| InChI | InChI=1S/C13H8F3N3/c14-13(15,16)10-4-1-3-9(7-10)11-8-17-12-5-2-6-18-19(11)12/h1-8H |
| InChIKey | STJUFOFONZNYEL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |