C14H10F3N5O — CID 2741018
N'-hydroxy-7-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboximidamide (PubChem CID 2741018) has the molecular formula C14H10F3N5O and a molecular weight of 321.26 g/mol. Its IUPAC name is N'-hydroxy-7-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboximidamide.
| Compound Name | N'-hydroxy-7-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboximidamide |
|---|---|
| PubChem CID | 2741018 |
| Molecular Formula | C14H10F3N5O |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N'-hydroxy-7-[3-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine-3-carboximidamide |
| SMILES | NC(=NO)c1cnn2c(-c3cccc(C(F)(F)F)c3)ccnc12 |
| InChI | InChI=1S/C14H10F3N5O/c15-14(16,17)9-3-1-2-8(6-9)11-4-5-19-13-10(12(18)21-23)7-20-22(11)13/h1-7,23H,(H2,18,21) |
| InChIKey | PZKPQONZOSUNSL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|