C19H26FN3O3 — CID 178051681
ethyl 7-[3-(4-fluoro-4-methylpiperidin-1-yl)propoxy]imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 178051681) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is ethyl 7-[3-(4-fluoro-4-methylpiperidin-1-yl)propoxy]imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 7-[3-(4-fluoro-4-methylpiperidin-1-yl)propoxy]imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 178051681 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl 7-[3-(4-fluoro-4-methylpiperidin-1-yl)propoxy]imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OCCCN3CCC(C)(F)CC3)ccn12 |
| InChI | InChI=1S/C19H26FN3O3/c1-3-25-18(24)16-14-21-17-13-15(5-9-23(16)17)26-12-4-8-22-10-6-19(2,20)7-11-22/h5,9,13-14H,3-4,6-8,10-12H2,1-2H3 |
| InChIKey | TUPOWGFJKUYLPA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|