C19H15NOS — CID 14615662
1-(4,6-diphenyl-2-sulfanylidene-1H-pyridin-3-yl)ethanone (PubChem CID 14615662) has the molecular formula C19H15NOS and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(4,6-diphenyl-2-sulfanylidene-1H-pyridin-3-yl)ethanone.
| Compound Name | 1-(4,6-diphenyl-2-sulfanylidene-1H-pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 14615662 |
| Molecular Formula | C19H15NOS |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-(4,6-diphenyl-2-sulfanylidene-1H-pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1c(-c2ccccc2)cc(-c2ccccc2)[nH]c1=S |
| InChI | InChI=1S/C19H15NOS/c1-13(21)18-16(14-8-4-2-5-9-14)12-17(20-19(18)22)15-10-6-3-7-11-15/h2-12H,1H3,(H,20,22) |
| InChIKey | HDBKFKZXOHCZCS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|