C33H24N2O — CID 153465332
bis(3,5-diphenyl-1H-pyrrol-2-yl)methanone (PubChem CID 153465332) has the molecular formula C33H24N2O and a molecular weight of 464.57 g/mol. Its IUPAC name is bis(3,5-diphenyl-1H-pyrrol-2-yl)methanone.
| Compound Name | bis(3,5-diphenyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 153465332 |
| Molecular Formula | C33H24N2O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | bis(3,5-diphenyl-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1[nH]c(-c2ccccc2)cc1-c1ccccc1)c1[nH]c(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C33H24N2O/c36-33(31-27(23-13-5-1-6-14-23)21-29(34-31)25-17-9-3-10-18-25)32-28(24-15-7-2-8-16-24)22-30(35-32)26-19-11-4-12-20-26/h1-22,34-35H |
| InChIKey | LQJLXQFARQTPOY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |