C36H43NO — CID 22648572
[3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-(2-methylphenyl)methanone (PubChem CID 22648572) has the molecular formula C36H43NO and a molecular weight of 505.75 g/mol. Its IUPAC name is [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-(2-methylphenyl)methanone.
| Compound Name | [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 22648572 |
| Molecular Formula | C36H43NO |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-(2-methylphenyl)methanone |
| SMILES | CCCCCCc1ccc(-c2cc(-c3ccc(CCCCCC)cc3)c(C(=O)c3ccccc3C)[nH]2)cc1 |
| InChI | InChI=1S/C36H43NO/c1-4-6-8-10-15-28-18-22-30(23-19-28)33-26-34(31-24-20-29(21-25-31)16-11-9-7-5-2)37-35(33)36(38)32-17-13-12-14-27(32)3/h12-14,17-26,37H,4-11,15-16H2,1-3H3 |
| InChIKey | LNVXDGWVPTVOPC-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|