C39H43NO — CID 22648584
[3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-naphthalen-1-ylmethanone (PubChem CID 22648584) has the molecular formula C39H43NO and a molecular weight of 541.78 g/mol. Its IUPAC name is [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-naphthalen-1-ylmethanone.
| Compound Name | [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 22648584 |
| Molecular Formula | C39H43NO |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | [3,5-bis(4-hexylphenyl)-1H-pyrrol-2-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCCCCc1ccc(-c2cc(-c3ccc(CCCCCC)cc3)c(C(=O)c3cccc4ccccc34)[nH]2)cc1 |
| InChI | InChI=1S/C39H43NO/c1-3-5-7-9-14-29-20-24-32(25-21-29)36-28-37(33-26-22-30(23-27-33)15-10-8-6-4-2)40-38(36)39(41)35-19-13-17-31-16-11-12-18-34(31)35/h11-13,16-28,40H,3-10,14-15H2,1-2H3 |
| InChIKey | YZPXATOZTVXDEN-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|