C26H20F3N3O3 — CID 88850560
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-phenyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 88850560) has the molecular formula C26H20F3N3O3 and a molecular weight of 479.46 g/mol. Its IUPAC name is N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-phenyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-phenyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 88850560 |
| Molecular Formula | C26H20F3N3O3 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-phenyl-3-[4-(trifluoromethyl)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NO)c1ccc(CNC(=O)c2[nH]c(-c3ccccc3)cc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H20F3N3O3/c27-26(28,29)20-12-10-17(11-13-20)21-14-22(18-4-2-1-3-5-18)31-23(21)25(34)30-15-16-6-8-19(9-7-16)24(33)32-35/h1-14,31,35H,15H2,(H,30,34)(H,32,33) |
| InChIKey | JKLOVHJBPLAOIQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|