C29H24N4O3S — CID 67082776
N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-3-yl-1H-pyrrole-2-carboxamide (PubChem CID 67082776) has the molecular formula C29H24N4O3S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-3-yl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-3-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 67082776 |
| Molecular Formula | C29H24N4O3S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-3-yl-1H-pyrrole-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)c2[nH]c(-c3ccsc3)cc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H24N4O3S/c30-24-3-1-2-4-25(24)33-28(35)20-7-5-18(6-8-20)16-31-29(36)27-23(19-9-11-22(34)12-10-19)15-26(32-27)21-13-14-37-17-21/h1-15,17,32,34H,16,30H2,(H,31,36)(H,33,35) |
| InChIKey | SEYQQVKFMOLZCN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|