C23H19N3O4S — CID 51039070
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-2-yl-1H-pyrrole-2-carboxamide (PubChem CID 51039070) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-2-yl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-2-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51039070 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-thiophen-2-yl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NO)c1ccc(CNC(=O)c2[nH]c(-c3cccs3)cc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H19N3O4S/c27-17-9-7-15(8-10-17)18-12-19(20-2-1-11-31-20)25-21(18)23(29)24-13-14-3-5-16(6-4-14)22(28)26-30/h1-12,25,27,30H,13H2,(H,24,29)(H,26,28) |
| InChIKey | LFEKORZSWOREFY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|