C26H20F2N2O3 — CID 148621746
4-[3-[3,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-3-oxopropyl]-N-hydroxybenzamide (PubChem CID 148621746) has the molecular formula C26H20F2N2O3 and a molecular weight of 446.45 g/mol. Its IUPAC name is 4-[3-[3,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-3-oxopropyl]-N-hydroxybenzamide.
| Compound Name | 4-[3-[3,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-3-oxopropyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 148621746 |
| Molecular Formula | C26H20F2N2O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[3-[3,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-3-oxopropyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CCC(=O)c2[nH]c(-c3ccc(F)cc3)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H20F2N2O3/c27-20-10-6-17(7-11-20)22-15-23(18-8-12-21(28)13-9-18)29-25(22)24(31)14-3-16-1-4-19(5-2-16)26(32)30-33/h1-2,4-13,15,29,33H,3,14H2,(H,30,32) |
| InChIKey | NGKCXJUSIYRAFH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|