C35H31N3O5S — CID 174667164
3-(4-methoxyphenyl)-5-phenyl-N-[[4-[(2-prop-2-enylsulfonylphenyl)carbamoyl]phenyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 174667164) has the molecular formula C35H31N3O5S and a molecular weight of 605.72 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-phenyl-N-[[4-[(2-prop-2-enylsulfonylphenyl)carbamoyl]phenyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-5-phenyl-N-[[4-[(2-prop-2-enylsulfonylphenyl)carbamoyl]phenyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 174667164 |
| Molecular Formula | C35H31N3O5S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-phenyl-N-[[4-[(2-prop-2-enylsulfonylphenyl)carbamoyl]phenyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | C=CCS(=O)(=O)c1ccccc1NC(=O)c1ccc(CNC(=O)c2[nH]c(-c3ccccc3)cc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H31N3O5S/c1-3-21-44(41,42)32-12-8-7-11-30(32)38-34(39)27-15-13-24(14-16-27)23-36-35(40)33-29(25-17-19-28(43-2)20-18-25)22-31(37-33)26-9-5-4-6-10-26/h3-20,22,37H,1,21,23H2,2H3,(H,36,40)(H,38,39) |
| InChIKey | HFEPZJDKLWMOFQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|