C28H22F3N3O4 — CID 177307933
5-benzoyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide (PubChem CID 177307933) has the molecular formula C28H22F3N3O4 and a molecular weight of 521.50 g/mol. Its IUPAC name is 5-benzoyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide.
| Compound Name | 5-benzoyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177307933 |
| Molecular Formula | C28H22F3N3O4 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 5-benzoyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
| SMILES | O=C(NO)c1ccc(CNC(=O)c2ccc(C(=O)c3ccccc3)n2Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H22F3N3O4/c29-28(30,31)22-12-8-19(9-13-22)17-34-23(25(35)20-4-2-1-3-5-20)14-15-24(34)27(37)32-16-18-6-10-21(11-7-18)26(36)33-38/h1-15,38H,16-17H2,(H,32,37)(H,33,36) |
| InChIKey | DGGLHZCAWMMOIZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|