C26H29NO4 — CID 157267999
methyl 8-[3-(4-methoxyphenyl)-5-phenyl-1H-pyrrol-2-yl]-8-oxooctanoate (PubChem CID 157267999) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl 8-[3-(4-methoxyphenyl)-5-phenyl-1H-pyrrol-2-yl]-8-oxooctanoate.
| Compound Name | methyl 8-[3-(4-methoxyphenyl)-5-phenyl-1H-pyrrol-2-yl]-8-oxooctanoate |
|---|---|
| PubChem CID | 157267999 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | methyl 8-[3-(4-methoxyphenyl)-5-phenyl-1H-pyrrol-2-yl]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)c1[nH]c(-c2ccccc2)cc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H29NO4/c1-30-21-16-14-19(15-17-21)22-18-23(20-10-6-5-7-11-20)27-26(22)24(28)12-8-3-4-9-13-25(29)31-2/h5-7,10-11,14-18,27H,3-4,8-9,12-13H2,1-2H3 |
| InChIKey | SEXDGUGYPXKXSQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|