C27H16N4O4S4 — CID 19931640
2-[2-[[2-(1,3-benzothiazol-2-yl)phenyl]sulfonyl-diazomethyl]sulfonylphenyl]-1,3-benzothiazole (PubChem CID 19931640) has the molecular formula C27H16N4O4S4 and a molecular weight of 588.72 g/mol. Its IUPAC name is 2-[2-[[2-(1,3-benzothiazol-2-yl)phenyl]sulfonyl-diazomethyl]sulfonylphenyl]-1,3-benzothiazole.
| Compound Name | 2-[2-[[2-(1,3-benzothiazol-2-yl)phenyl]sulfonyl-diazomethyl]sulfonylphenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 19931640 |
| Molecular Formula | C27H16N4O4S4 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.01 |
| IUPAC Name | 2-[2-[[2-(1,3-benzothiazol-2-yl)phenyl]sulfonyl-diazomethyl]sulfonylphenyl]-1,3-benzothiazole |
| SMILES | [N-]=[N+]=C(S(=O)(=O)c1ccccc1-c1nc2ccccc2s1)S(=O)(=O)c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H16N4O4S4/c28-31-27(38(32,33)23-15-7-1-9-17(23)25-29-19-11-3-5-13-21(19)36-25)39(34,35)24-16-8-2-10-18(24)26-30-20-12-4-6-14-22(20)37-26/h1-16H |
| InChIKey | JLHFJACSOABMDB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 130.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|