C20H15N3O5S3 — CID 142784637
4-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 142784637) has the molecular formula C20H15N3O5S3 and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 142784637 |
| Molecular Formula | C20H15N3O5S3 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | NC(=O)c1ccc(-c2nc3ccccc3s2)c(S(=O)(=O)c2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H15N3O5S3/c21-19(24)12-9-10-13(20-23-14-5-1-2-6-15(14)29-20)18(11-12)30(25,26)16-7-3-4-8-17(16)31(22,27)28/h1-11H,(H2,21,24)(H2,22,27,28) |
| InChIKey | HWFHIUKSGMAYJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |