C16H10N2OS2 — CID 146346348
3-(1,3-benzothiazol-2-yl)-1-benzothiophene-5-carboxamide (PubChem CID 146346348) has the molecular formula C16H10N2OS2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-benzothiophene-5-carboxamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 146346348 |
| Molecular Formula | C16H10N2OS2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-benzothiophene-5-carboxamide |
| SMILES | NC(=O)c1ccc2scc(-c3nc4ccccc4s3)c2c1 |
| InChI | InChI=1S/C16H10N2OS2/c17-15(19)9-5-6-13-10(7-9)11(8-20-13)16-18-12-3-1-2-4-14(12)21-16/h1-8H,(H2,17,19) |
| InChIKey | LEBGDYDUJQWIBC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |