C27H21N5O2S — CID 5068021
4-amino-N-[4-[(4-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)phenyl]benzamide (PubChem CID 5068021) has the molecular formula C27H21N5O2S and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-amino-N-[4-[(4-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[(4-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 5068021 |
| Molecular Formula | C27H21N5O2S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-amino-N-[4-[(4-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)phenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(N)cc3)c(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C27H21N5O2S/c28-18-9-5-16(6-10-18)25(33)30-20-13-14-22(31-26(34)17-7-11-19(29)12-8-17)21(15-20)27-32-23-3-1-2-4-24(23)35-27/h1-15H,28-29H2,(H,30,33)(H,31,34) |
| InChIKey | YUYWNOCTBWBMJI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|