C16H10N2S2 — CID 2512502
4-(1,3-benzothiazol-2-yl)-1H-quinoline-2-thione (PubChem CID 2512502) has the molecular formula C16H10N2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1H-quinoline-2-thione.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 2512502 |
| Molecular Formula | C16H10N2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1H-quinoline-2-thione |
| SMILES | S=c1cc(-c2nc3ccccc3s2)c2ccccc2[nH]1 |
| InChI | InChI=1S/C16H10N2S2/c19-15-9-11(10-5-1-2-6-12(10)17-15)16-18-13-7-3-4-8-14(13)20-16/h1-9H,(H,17,19) |
| InChIKey | KBALDYMOEFKWSY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|