C22H15NO4S — CID 137228104
2-(1,3-benzothiazol-2-yl)-1,6,8-trihydroxy-3-methyl-10H-anthracen-9-one (PubChem CID 137228104) has the molecular formula C22H15NO4S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1,6,8-trihydroxy-3-methyl-10H-anthracen-9-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1,6,8-trihydroxy-3-methyl-10H-anthracen-9-one |
|---|---|
| PubChem CID | 137228104 |
| Molecular Formula | C22H15NO4S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1,6,8-trihydroxy-3-methyl-10H-anthracen-9-one |
| SMILES | Cc1cc2c(c(O)c1-c1nc3ccccc3s1)C(=O)c1c(O)cc(O)cc1C2 |
| InChI | InChI=1S/C22H15NO4S/c1-10-6-11-7-12-8-13(24)9-15(25)18(12)21(27)19(11)20(26)17(10)22-23-14-4-2-3-5-16(14)28-22/h2-6,8-9,24-26H,7H2,1H3 |
| InChIKey | XFDDXNKKFWNHSM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |