C44H16F10N2S2 — CID 169314048
2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole (PubChem CID 169314048) has the molecular formula C44H16F10N2S2 and a molecular weight of 826.74 g/mol. Its IUPAC name is 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole.
| Compound Name | 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 169314048 |
| Molecular Formula | C44H16F10N2S2 |
| Molecular Weight | 826.74 g/mol |
| Exact Mass | 826.06 |
| IUPAC Name | 2,7-bis[6-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzothiazole |
| SMILES | Fc1c(F)c(F)c(-c2ccc3cc(-c4nc5cc6cc7sc(-c8ccc9cc(-c%10c(F)c(F)c(F)c(F)c%10F)ccc9c8)nc7cc6cc5s4)ccc3c2)c(F)c1F |
| InChI | InChI=1S/C44H16F10N2S2/c45-33-31(34(46)38(50)41(53)37(33)49)21-5-1-19-11-23(7-3-17(19)9-21)43-55-27-13-25-16-30-28(14-26(25)15-29(27)57-43)56-44(58-30)24-8-4-18-10-22(6-2-20(18)12-24)32-35(47)39(51)42(54)40(52)36(32)48/h1-16H |
| InChIKey | NYRFBINREDLJHR-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.74 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|