C25H20NO5+ — CID 134912639
2,6-bis(4-methoxyphenyl)-4-(3-nitrophenyl)pyrylium (PubChem CID 134912639) has the molecular formula C25H20NO5+ and a molecular weight of 414.44 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-4-(3-nitrophenyl)pyrylium.
| Compound Name | 2,6-bis(4-methoxyphenyl)-4-(3-nitrophenyl)pyrylium |
|---|---|
| PubChem CID | 134912639 |
| Molecular Formula | C25H20NO5+ |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-4-(3-nitrophenyl)pyrylium |
| SMILES | COc1ccc(-c2cc(-c3cccc([N+](=O)[O-])c3)cc(-c3ccc(OC)cc3)[o+]2)cc1 |
| InChI | InChI=1S/C25H20NO5/c1-29-22-10-6-17(7-11-22)24-15-20(19-4-3-5-21(14-19)26(27)28)16-25(31-24)18-8-12-23(30-2)13-9-18/h3-16H,1-2H3/q+1 |
| InChIKey | KJXUIYONZWPFNK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|