C12H6F3N5O3S — CID 19778983
azanylidyneazanium;2-phenylethene-1,1,2-tricarbonitrile;trifluoromethanesulfonate (PubChem CID 19778983) has the molecular formula C12H6F3N5O3S and a molecular weight of 357.27 g/mol. Its IUPAC name is azanylidyneazanium;2-phenylethene-1,1,2-tricarbonitrile;trifluoromethanesulfonate.
| Compound Name | azanylidyneazanium;2-phenylethene-1,1,2-tricarbonitrile;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19778983 |
| Molecular Formula | C12H6F3N5O3S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | azanylidyneazanium;2-phenylethene-1,1,2-tricarbonitrile;trifluoromethanesulfonate |
| SMILES | N#CC(C#N)=C(C#N)c1ccccc1.N#[NH+].O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H5N3.CHF3O3S.N2/c12-6-10(7-13)11(8-14)9-4-2-1-3-5-9;2-1(3,4)8(5,6)7;1-2/h1-5H;(H,5,6,7); |
| InChIKey | ISSRIKZHSMXQGZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 176.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|