C12H7F3N2O — CID 139913049
2-phenyl-3-(2,2,2-trifluoroethoxy)but-2-enedinitrile (PubChem CID 139913049) has the molecular formula C12H7F3N2O and a molecular weight of 252.19 g/mol. Its IUPAC name is 2-phenyl-3-(2,2,2-trifluoroethoxy)but-2-enedinitrile.
| Compound Name | 2-phenyl-3-(2,2,2-trifluoroethoxy)but-2-enedinitrile |
|---|---|
| PubChem CID | 139913049 |
| Molecular Formula | C12H7F3N2O |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-phenyl-3-(2,2,2-trifluoroethoxy)but-2-enedinitrile |
| SMILES | N#CC(OCC(F)(F)F)=C(C#N)c1ccccc1 |
| InChI | InChI=1S/C12H7F3N2O/c13-12(14,15)8-18-11(7-17)10(6-16)9-4-2-1-3-5-9/h1-5H,8H2 |
| InChIKey | LRQCCIPFJBTCEA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|