C12H11F6O2P — CID 14341019
1-phenylethenyl-bis(2,2,2-trifluoroethoxy)phosphane (PubChem CID 14341019) has the molecular formula C12H11F6O2P and a molecular weight of 332.18 g/mol. Its IUPAC name is 1-phenylethenyl-bis(2,2,2-trifluoroethoxy)phosphane.
| Compound Name | 1-phenylethenyl-bis(2,2,2-trifluoroethoxy)phosphane |
|---|---|
| PubChem CID | 14341019 |
| Molecular Formula | C12H11F6O2P |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-phenylethenyl-bis(2,2,2-trifluoroethoxy)phosphane |
| SMILES | C=C(c1ccccc1)P(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C12H11F6O2P/c1-9(10-5-3-2-4-6-10)21(19-7-11(13,14)15)20-8-12(16,17)18/h2-6H,1,7-8H2 |
| InChIKey | UKPWFRSYNHUTLU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|