C9H8F3NO — CID 102041341
2,2,2-trifluoroethyl benzenecarboximidate (PubChem CID 102041341) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl benzenecarboximidate.
| Compound Name | 2,2,2-trifluoroethyl benzenecarboximidate |
|---|---|
| PubChem CID | 102041341 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2,2,2-trifluoroethyl benzenecarboximidate |
| SMILES | [H]/N=C(\OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H8F3NO/c10-9(11,12)6-14-8(13)7-4-2-1-3-5-7/h1-5,13H,6H2/b13-8- |
| InChIKey | YUDMSMMSANIYHL-JYRVWZFOSA-N |
| XLogP | 2.59 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|