C12H13F3N2O — CID 143937185
ethyl (Z)-3-amino-4,4,4-trifluoro-2-phenylbut-2-enimidate (PubChem CID 143937185) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is ethyl (Z)-3-amino-4,4,4-trifluoro-2-phenylbut-2-enimidate.
| Compound Name | ethyl (Z)-3-amino-4,4,4-trifluoro-2-phenylbut-2-enimidate |
|---|---|
| PubChem CID | 143937185 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl (Z)-3-amino-4,4,4-trifluoro-2-phenylbut-2-enimidate |
| SMILES | [H]/N=C(OCC)/C(=C(\N)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H13F3N2O/c1-2-18-11(17)9(10(16)12(13,14)15)8-6-4-3-5-7-8/h3-7,17H,2,16H2,1H3/b10-9-,17-11- |
| InChIKey | GEQJPXSWRGOUAJ-XJPAVUHSSA-N |
| XLogP | 2.93 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|