About [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene
[[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene (PubChem CID 158946878) has the molecular formula C21H13ClF3N3O5S
and a molecular weight of 511.87 g/mol. Its IUPAC name is [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene |
| PubChem CID | 158946878 |
| Molecular Formula | C21H13ClF3N3O5S |
| Molecular Weight | 511.87 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene |
| SMILES | N#CC(=NOS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1.O=[N+]([O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9ClN2O3S.C7H4F3NO2/c15-12-8-6-11(7-9-12)14(10-16)17-20-21(18,19)13-4-2-1-3-5-13;8-7(9,10)5-2-1-3-6(4-5)11(12)13/h1-9H;1-4H |
| InChIKey | JKXWDGODZCJHFT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 122.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene?
The IUPAC name of [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene (CID 158946878) is [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene.
What is the SMILES notation for [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene?
The canonical SMILES for [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene is N#CC(=NOS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1.O=[N+]([O-])c1cccc(C(F)(F)F)c1.
What is the InChIKey of [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene?
The InChIKey is JKXWDGODZCJHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2O3S.C7H4F3NO2/c15-12-8-6-11(7-9-12)14(10-16)17-20-21(18,19)13-4-2-1-3-5-13;8-7(9,10)5-2-1-3-6(4-5)11(12)13/h1-9H;1-4H.
What are the key properties of [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene?
[[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene has a molecular weight of 511.87 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[(4-chlorophenyl)-cyanomethylidene]amino] benzenesulfonate;1-nitro-3-(trifluoromethyl)benzene is sourced from PubChem (CID 158946878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).