C17H24N2O4S — CID 102380456
[(E)-[cyano-(4-methoxyphenyl)methylidene]amino] octane-1-sulfonate (PubChem CID 102380456) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] octane-1-sulfonate.
| Compound Name | [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] octane-1-sulfonate |
|---|---|
| PubChem CID | 102380456 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)O/N=C(/C#N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-3-4-5-6-7-8-13-24(20,21)23-19-17(14-18)15-9-11-16(22-2)12-10-15/h9-12H,3-8,13H2,1-2H3/b19-17- |
| InChIKey | AXJNFINWUUSNRX-ZPHPHTNESA-N |
| XLogP | 3.63 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|