C19H18F3NO3S — CID 76679356
[[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] butane-1-sulfonate (PubChem CID 76679356) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is [[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] butane-1-sulfonate.
| Compound Name | [[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] butane-1-sulfonate |
|---|---|
| PubChem CID | 76679356 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)ON=C(c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO3S/c1-2-3-10-27(24,25)26-23-18(19(20,21)22)14-8-9-17-15(12-14)11-13-6-4-5-7-16(13)17/h4-9,12H,2-3,10-11H2,1H3 |
| InChIKey | YCPMBPJHTFCLOI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|