C38H46F5NO8S2 — CID 134460929
4-O-[4-tert-butyl-2,6-bis(methoxymethyl)phenyl] 2-O-[(Z)-[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] 4-ethyl-3,3-difluoro-2-methylhexane-2,4-disulfonate (PubChem CID 134460929) has the molecular formula C38H46F5NO8S2 and a molecular weight of 803.91 g/mol. Its IUPAC name is 4-O-[4-tert-butyl-2,6-bis(methoxymethyl)phenyl] 2-O-[(Z)-[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] 4-ethyl-3,3-difluoro-2-methylhexane-2,4-disulfonate.
| Compound Name | 4-O-[4-tert-butyl-2,6-bis(methoxymethyl)phenyl] 2-O-[(Z)-[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] 4-ethyl-3,3-difluoro-2-methylhexane-2,4-disulfonate |
|---|---|
| PubChem CID | 134460929 |
| Molecular Formula | C38H46F5NO8S2 |
| Molecular Weight | 803.91 g/mol |
| Exact Mass | 803.26 |
| IUPAC Name | 4-O-[4-tert-butyl-2,6-bis(methoxymethyl)phenyl] 2-O-[(Z)-[1-(9H-fluoren-2-yl)-2,2,2-trifluoroethylidene]amino] 4-ethyl-3,3-difluoro-2-methylhexane-2,4-disulfonate |
| SMILES | CCC(CC)(C(F)(F)C(C)(C)S(=O)(=O)O/N=C(/c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)F)S(=O)(=O)Oc1c(COC)cc(C(C)(C)C)cc1COC |
| InChI | InChI=1S/C38H46F5NO8S2/c1-10-36(11-2,54(47,48)51-32-27(22-49-8)20-29(34(3,4)5)21-28(32)23-50-9)38(42,43)35(6,7)53(45,46)52-44-33(37(39,40)41)25-16-17-31-26(19-25)18-24-14-12-13-15-30(24)31/h12-17,19-21H,10-11,18,22-23H2,1-9H3/b44-33- |
| InChIKey | KBDBUCDCWPBAEU-SWYSEXKRSA-N |
| XLogP | 8.84 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.91 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|