C25H22N2O5S2 — CID 24510525
[2-methoxy-4-[(Z)-[1-(2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 24510525) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[1-(2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-[1-(2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24510525 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [2-methoxy-4-[(Z)-[1-(2-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C2\NC(=S)N(c3ccccc3C)C2=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-16-8-11-19(12-9-16)34(29,30)32-22-13-10-18(15-23(22)31-3)14-20-24(28)27(25(33)26-20)21-7-5-4-6-17(21)2/h4-15H,1-3H3,(H,26,33)/b20-14- |
| InChIKey | XDDBLLBFCVRYQC-ZHZULCJRSA-N |
| XLogP | 4.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|