C24H16F3NO5S — CID 126329003
(2Z)-2-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1-benzothiophen-3-one (PubChem CID 126329003) has the molecular formula C24H16F3NO5S and a molecular weight of 487.46 g/mol. Its IUPAC name is (2Z)-2-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 126329003 |
| Molecular Formula | C24H16F3NO5S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (2Z)-2-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1-benzothiophen-3-one |
| SMILES | CCOc1cc(/C=C2\Sc3ccccc3C2=O)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16F3NO5S/c1-2-32-20-11-14(12-22-23(29)16-5-3-4-6-21(16)34-22)7-9-19(20)33-18-10-8-15(24(25,26)27)13-17(18)28(30)31/h3-13H,2H2,1H3/b22-12- |
| InChIKey | LTUHYMJTDCMPQS-UUYOSTAYSA-N |
| XLogP | 7.13 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|