C16H19N3O3S — CID 102578932
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-1-sulfanylidene-6,7,8,9-tetrahydropyridazino[1,2-a][1,2,4]triazin-4-one (PubChem CID 102578932) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-1-sulfanylidene-6,7,8,9-tetrahydropyridazino[1,2-a][1,2,4]triazin-4-one.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-1-sulfanylidene-6,7,8,9-tetrahydropyridazino[1,2-a][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 102578932 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-1-sulfanylidene-6,7,8,9-tetrahydropyridazino[1,2-a][1,2,4]triazin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N3CCCCN3C2=O)cc1OC |
| InChI | InChI=1S/C16H19N3O3S/c1-21-13-6-5-11(10-14(13)22-2)9-12-15(20)18-7-3-4-8-19(18)16(23)17-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,23)/b12-9- |
| InChIKey | ZKVJHYKMOJFRMN-XFXZXTDPSA-N |
| XLogP | 1.77 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|