C19H23BrN2O2 — CID 150539071
(4S)-1-(4-bromophenyl)-7,8-dimethoxy-2,4-dimethyl-1,3,4,5-tetrahydro-2,3-benzodiazepine (PubChem CID 150539071) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is (4S)-1-(4-bromophenyl)-7,8-dimethoxy-2,4-dimethyl-1,3,4,5-tetrahydro-2,3-benzodiazepine.
| Compound Name | (4S)-1-(4-bromophenyl)-7,8-dimethoxy-2,4-dimethyl-1,3,4,5-tetrahydro-2,3-benzodiazepine |
|---|---|
| PubChem CID | 150539071 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4S)-1-(4-bromophenyl)-7,8-dimethoxy-2,4-dimethyl-1,3,4,5-tetrahydro-2,3-benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(Br)cc1)N(C)N[C@@H](C)C2 |
| InChI | InChI=1S/C19H23BrN2O2/c1-12-9-14-10-17(23-3)18(24-4)11-16(14)19(22(2)21-12)13-5-7-15(20)8-6-13/h5-8,10-12,19,21H,9H2,1-4H3/t12-,19?/m0/s1 |
| InChIKey | IFMFUOVLSYAMGZ-HSLMYDHPSA-N |
| XLogP | 3.94 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |