C11H9NO4 — CID 70294296
(5Z)-5-[(3-methoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 70294296) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is (5Z)-5-[(3-methoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-methoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 70294296 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (5Z)-5-[(3-methoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | COc1cccc(/C=C2\OC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H9NO4/c1-15-8-4-2-3-7(5-8)6-9-10(13)12-11(14)16-9/h2-6H,1H3,(H,12,13,14)/b9-6- |
| InChIKey | GSBCAPJCQAFTOC-TWGQIWQCSA-N |
| XLogP | 1.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|