C16H12O5 — CID 46838130
(2Z)-4,6-dihydroxy-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 46838130) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-4,6-dihydroxy-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 46838130 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[(3-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1cccc(/C=C2\Oc3cc(O)cc(O)c3C2=O)c1 |
| InChI | InChI=1S/C16H12O5/c1-20-11-4-2-3-9(5-11)6-14-16(19)15-12(18)7-10(17)8-13(15)21-14/h2-8,17-18H,1H3/b14-6- |
| InChIKey | YNGRNXRMMILOQC-NSIKDUERSA-N |
| XLogP | 2.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|