C16H12O6 — CID 169438541
(2Z)-4,6-dihydroxy-2-[[3-hydroxy-4-(trideuteriomethoxy)phenyl]methylidene]-1-benzofuran-3-one (PubChem CID 169438541) has the molecular formula C16H12O6 and a molecular weight of 303.28 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[[3-hydroxy-4-(trideuteriomethoxy)phenyl]methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-4,6-dihydroxy-2-[[3-hydroxy-4-(trideuteriomethoxy)phenyl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 169438541 |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[[3-hydroxy-4-(trideuteriomethoxy)phenyl]methylidene]-1-benzofuran-3-one |
| SMILES | [2H]C([2H])([2H])Oc1ccc(/C=C2\Oc3cc(O)cc(O)c3C2=O)cc1O |
| InChI | InChI=1S/C16H12O6/c1-21-12-3-2-8(4-10(12)18)5-14-16(20)15-11(19)6-9(17)7-13(15)22-14/h2-7,17-19H,1H3/b14-5-/i1D3 |
| InChIKey | WKEOZXMSVNVPCM-ASUDCTPZSA-N |
| XLogP | 2.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|