C18H14N2O4 — CID 5205185
3,6-bis[(3-hydroxyphenyl)methylidene]piperazine-2,5-dione (PubChem CID 5205185) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 3,6-bis[(3-hydroxyphenyl)methylidene]piperazine-2,5-dione.
| Compound Name | 3,6-bis[(3-hydroxyphenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 5205185 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3,6-bis[(3-hydroxyphenyl)methylidene]piperazine-2,5-dione |
| SMILES | O=c1[nH]c(=Cc2cccc(O)c2)c(=O)[nH]c1=Cc1cccc(O)c1 |
| InChI | InChI=1S/C18H14N2O4/c21-13-5-1-3-11(7-13)9-15-17(23)20-16(18(24)19-15)10-12-4-2-6-14(22)8-12/h1-10,21-22H,(H,19,24)(H,20,23) |
| InChIKey | KKEUNBNPGVHQQB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |