C14H14N2O2 — CID 3866178
3-benzylidene-6-propylidenepiperazine-2,5-dione (PubChem CID 3866178) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-benzylidene-6-propylidenepiperazine-2,5-dione.
| Compound Name | 3-benzylidene-6-propylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 3866178 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-benzylidene-6-propylidenepiperazine-2,5-dione |
| SMILES | CCC=c1[nH]c(=O)c(=Cc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C14H14N2O2/c1-2-6-11-13(17)16-12(14(18)15-11)9-10-7-4-3-5-8-10/h3-9H,2H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | RDYRIFXYPQHWDP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |