C15H14N2O2 — CID 5359203
(3E,6E)-3-benzylidene-6-but-2-enylidenepiperazine-2,5-dione (PubChem CID 5359203) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (3E,6E)-3-benzylidene-6-but-2-enylidenepiperazine-2,5-dione.
| Compound Name | (3E,6E)-3-benzylidene-6-but-2-enylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 5359203 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (3E,6E)-3-benzylidene-6-but-2-enylidenepiperazine-2,5-dione |
| SMILES | CC=C/C=c1/[nH]c(=O)/c(=C\c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C15H14N2O2/c1-2-3-9-12-14(18)17-13(15(19)16-12)10-11-7-5-4-6-8-11/h2-10H,1H3,(H,16,19)(H,17,18)/b3-2?,12-9+,13-10+ |
| InChIKey | BLJUUFICOYJFEX-ILNSXCFQSA-N |
| XLogP | 0.25 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |