C20H18N2O6 — CID 3391519
3,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperazine-2,5-dione (PubChem CID 3391519) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 3,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperazine-2,5-dione.
| Compound Name | 3,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 3391519 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3,6-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperazine-2,5-dione |
| SMILES | COc1cc(C=c2[nH]c(=O)c(=Cc3ccc(O)c(OC)c3)[nH]c2=O)ccc1O |
| InChI | InChI=1S/C20H18N2O6/c1-27-17-9-11(3-5-15(17)23)7-13-19(25)22-14(20(26)21-13)8-12-4-6-16(24)18(10-12)28-2/h3-10,23-24H,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | IXHFRXDLUKWPHG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |