C12H11NO4 — CID 741231
(3Z)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,4-dione (PubChem CID 741231) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (3Z)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 741231 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (3Z)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/C(=O)CNC2=O)ccc1O |
| InChI | InChI=1S/C12H11NO4/c1-17-11-5-7(2-3-9(11)14)4-8-10(15)6-13-12(8)16/h2-5,14H,6H2,1H3,(H,13,16)/b8-4- |
| InChIKey | WUKYSHSRTGYFLQ-YWEYNIOJSA-N |
| XLogP | 0.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|