C16H12ClNO3 — CID 78212058
6-chloro-3-[(4-hydroxy-3-methoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 78212058) has the molecular formula C16H12ClNO3 and a molecular weight of 301.73 g/mol. Its IUPAC name is 6-chloro-3-[(4-hydroxy-3-methoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 6-chloro-3-[(4-hydroxy-3-methoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 78212058 |
| Molecular Formula | C16H12ClNO3 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 6-chloro-3-[(4-hydroxy-3-methoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(C=C2C(=O)Nc3cc(Cl)ccc32)ccc1O |
| InChI | InChI=1S/C16H12ClNO3/c1-21-15-7-9(2-5-14(15)19)6-12-11-4-3-10(17)8-13(11)18-16(12)20/h2-8,19H,1H3,(H,18,20) |
| InChIKey | JBPHRNIKVNCWPR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|