C12H12N2O6S — CID 141167156
(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-methylsulfonylimidazolidine-2,4-dione (PubChem CID 141167156) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-methylsulfonylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-methylsulfonylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141167156 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-methylsulfonylimidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\NC(=O)N(S(C)(=O)=O)C2=O)ccc1O |
| InChI | InChI=1S/C12H12N2O6S/c1-20-10-6-7(3-4-9(10)15)5-8-11(16)14(12(17)13-8)21(2,18)19/h3-6,15H,1-2H3,(H,13,17)/b8-5- |
| InChIKey | NPWROHNECKWGCN-YVMONPNESA-N |
| XLogP | 0.25 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|